About [(2E,4E)-4-ethylhexa-2,4-dienyl] N-ethylcarbamate
[(2E,4E)-4-ethylhexa-2,4-dienyl] N-ethylcarbamate (PubChem CID 86749293) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is [(2E,4E)-4-ethylhexa-2,4-dienyl] N-ethylcarbamate.
Molecular Properties
| Compound Name | [(2E,4E)-4-ethylhexa-2,4-dienyl] N-ethylcarbamate |
| PubChem CID | 86749293 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | [(2E,4E)-4-ethylhexa-2,4-dienyl] N-ethylcarbamate |
| SMILES | C/C=C(/C=C/COC(=O)NCC)CC |
| InChI | InChI=1S/C11H19NO2/c1-4-10(5-2)8-7-9-14-11(13)12-6-3/h4,7-8H,5-6,9H2,1-3H3,(H,12,13)/b8-7+,10-4+ |
| InChIKey | NOEPWHCFOMJOLP-IJKCFHSJSA-N |
| XLogP | 2.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2E,4E)-4-ethylhexa-2,4-dienyl] N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E,4E)-4-ethylhexa-2,4-dienyl] N-ethylcarbamate?
The IUPAC name of [(2E,4E)-4-ethylhexa-2,4-dienyl] N-ethylcarbamate (CID 86749293) is [(2E,4E)-4-ethylhexa-2,4-dienyl] N-ethylcarbamate.
What is the SMILES notation for [(2E,4E)-4-ethylhexa-2,4-dienyl] N-ethylcarbamate?
The canonical SMILES for [(2E,4E)-4-ethylhexa-2,4-dienyl] N-ethylcarbamate is C/C=C(/C=C/COC(=O)NCC)CC.
What is the InChIKey of [(2E,4E)-4-ethylhexa-2,4-dienyl] N-ethylcarbamate?
The InChIKey is NOEPWHCFOMJOLP-IJKCFHSJSA-N. The full InChI is InChI=1S/C11H19NO2/c1-4-10(5-2)8-7-9-14-11(13)12-6-3/h4,7-8H,5-6,9H2,1-3H3,(H,12,13)/b8-7+,10-4+.
What are the key properties of [(2E,4E)-4-ethylhexa-2,4-dienyl] N-ethylcarbamate?
[(2E,4E)-4-ethylhexa-2,4-dienyl] N-ethylcarbamate has a molecular weight of 197.28 g/mol, XLogP of 2.64, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E,4E)-4-ethylhexa-2,4-dienyl] N-ethylcarbamate is sourced from PubChem (CID 86749293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).