About lithium 6-(dimethylaminomethylidene)-4-methylcyclohexa-2,4-dien-1-olate
lithium 6-(dimethylaminomethylidene)-4-methylcyclohexa-2,4-dien-1-olate (PubChem CID 86750153) has the molecular formula C10H14LiNO
and a molecular weight of 171.17 g/mol. Its IUPAC name is lithium 6-(dimethylaminomethylidene)-4-methylcyclohexa-2,4-dien-1-olate.
Molecular Properties
| Compound Name | lithium 6-(dimethylaminomethylidene)-4-methylcyclohexa-2,4-dien-1-olate |
| PubChem CID | 86750153 |
| Molecular Formula | C10H14LiNO |
| Molecular Weight | 171.17 g/mol |
| Exact Mass | 171.12 |
| IUPAC Name | lithium 6-(dimethylaminomethylidene)-4-methylcyclohexa-2,4-dien-1-olate |
| SMILES | CC1=CC(=CN(C)C)C([O-])C=C1.[Li+] |
| InChI | InChI=1S/C10H14NO.Li/c1-8-4-5-10(12)9(6-8)7-11(2)3;/h4-7,10H,1-3H3;/q-1;+1 |
| InChIKey | WQAMLTBRXSWMJW-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.17 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze lithium 6-(dimethylaminomethylidene)-4-methylcyclohexa-2,4-dien-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 6-(dimethylaminomethylidene)-4-methylcyclohexa-2,4-dien-1-olate?
The IUPAC name of lithium 6-(dimethylaminomethylidene)-4-methylcyclohexa-2,4-dien-1-olate (CID 86750153) is lithium 6-(dimethylaminomethylidene)-4-methylcyclohexa-2,4-dien-1-olate.
What is the SMILES notation for lithium 6-(dimethylaminomethylidene)-4-methylcyclohexa-2,4-dien-1-olate?
The canonical SMILES for lithium 6-(dimethylaminomethylidene)-4-methylcyclohexa-2,4-dien-1-olate is CC1=CC(=CN(C)C)C([O-])C=C1.[Li+].
What is the InChIKey of lithium 6-(dimethylaminomethylidene)-4-methylcyclohexa-2,4-dien-1-olate?
The InChIKey is WQAMLTBRXSWMJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14NO.Li/c1-8-4-5-10(12)9(6-8)7-11(2)3;/h4-7,10H,1-3H3;/q-1;+1.
What are the key properties of lithium 6-(dimethylaminomethylidene)-4-methylcyclohexa-2,4-dien-1-olate?
lithium 6-(dimethylaminomethylidene)-4-methylcyclohexa-2,4-dien-1-olate has a molecular weight of 171.17 g/mol, XLogP of -2.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 6-(dimethylaminomethylidene)-4-methylcyclohexa-2,4-dien-1-olate is sourced from PubChem (CID 86750153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).