C20H19N3S2 — CID 86750191
1-(1H-benzo[e][1,2]benzothiazol-2-yl)-3-(2-phenylethyl)thiourea (PubChem CID 86750191) has the molecular formula C20H19N3S2 and a molecular weight of 365.53 g/mol. Its IUPAC name is 1-(1H-benzo[e][1,2]benzothiazol-2-yl)-3-(2-phenylethyl)thiourea.
| Compound Name | 1-(1H-benzo[e][1,2]benzothiazol-2-yl)-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 86750191 |
| Molecular Formula | C20H19N3S2 |
| Molecular Weight | 365.53 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 1-(1H-benzo[e][1,2]benzothiazol-2-yl)-3-(2-phenylethyl)thiourea |
| SMILES | S=C(NCCc1ccccc1)NN1Cc2c(ccc3ccccc23)S1 |
| InChI | InChI=1S/C20H19N3S2/c24-20(21-13-12-15-6-2-1-3-7-15)22-23-14-18-17-9-5-4-8-16(17)10-11-19(18)25-23/h1-11H,12-14H2,(H2,21,22,24) |
| InChIKey | VMTAQZZZMDZUQX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|