About S-[(3S,5R)-5-[(4-fluorophenyl)sulfonylmethyl]oxolan-3-yl] ethanethioate
S-[(3S,5R)-5-[(4-fluorophenyl)sulfonylmethyl]oxolan-3-yl] ethanethioate (PubChem CID 86750317) has the molecular formula C13H15FO4S2
and a molecular weight of 318.39 g/mol. Its IUPAC name is S-[(3S,5R)-5-[(4-fluorophenyl)sulfonylmethyl]oxolan-3-yl] ethanethioate.
Molecular Properties
| Compound Name | S-[(3S,5R)-5-[(4-fluorophenyl)sulfonylmethyl]oxolan-3-yl] ethanethioate |
| PubChem CID | 86750317 |
| Molecular Formula | C13H15FO4S2 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | S-[(3S,5R)-5-[(4-fluorophenyl)sulfonylmethyl]oxolan-3-yl] ethanethioate |
| SMILES | CC(=O)S[C@@H]1CO[C@@H](CS(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C13H15FO4S2/c1-9(15)19-12-6-11(18-7-12)8-20(16,17)13-4-2-10(14)3-5-13/h2-5,11-12H,6-8H2,1H3/t11-,12+/m1/s1 |
| InChIKey | WDQWLRFARWBRMZ-NEPJUHHUSA-N |
| XLogP | 2.04 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(3S,5R)-5-[(4-fluorophenyl)sulfonylmethyl]oxolan-3-yl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(3S,5R)-5-[(4-fluorophenyl)sulfonylmethyl]oxolan-3-yl] ethanethioate?
The IUPAC name of S-[(3S,5R)-5-[(4-fluorophenyl)sulfonylmethyl]oxolan-3-yl] ethanethioate (CID 86750317) is S-[(3S,5R)-5-[(4-fluorophenyl)sulfonylmethyl]oxolan-3-yl] ethanethioate.
What is the SMILES notation for S-[(3S,5R)-5-[(4-fluorophenyl)sulfonylmethyl]oxolan-3-yl] ethanethioate?
The canonical SMILES for S-[(3S,5R)-5-[(4-fluorophenyl)sulfonylmethyl]oxolan-3-yl] ethanethioate is CC(=O)S[C@@H]1CO[C@@H](CS(=O)(=O)c2ccc(F)cc2)C1.
What is the InChIKey of S-[(3S,5R)-5-[(4-fluorophenyl)sulfonylmethyl]oxolan-3-yl] ethanethioate?
The InChIKey is WDQWLRFARWBRMZ-NEPJUHHUSA-N. The full InChI is InChI=1S/C13H15FO4S2/c1-9(15)19-12-6-11(18-7-12)8-20(16,17)13-4-2-10(14)3-5-13/h2-5,11-12H,6-8H2,1H3/t11-,12+/m1/s1.
What are the key properties of S-[(3S,5R)-5-[(4-fluorophenyl)sulfonylmethyl]oxolan-3-yl] ethanethioate?
S-[(3S,5R)-5-[(4-fluorophenyl)sulfonylmethyl]oxolan-3-yl] ethanethioate has a molecular weight of 318.39 g/mol, XLogP of 2.04, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(3S,5R)-5-[(4-fluorophenyl)sulfonylmethyl]oxolan-3-yl] ethanethioate is sourced from PubChem (CID 86750317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).