C9H14F3NO6S — CID 86750394
N-[(2S,3R,4S)-3,6-dihydroxy-2-methyl-3-methylsulfonyloxan-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 86750394) has the molecular formula C9H14F3NO6S and a molecular weight of 321.27 g/mol. Its IUPAC name is N-[(2S,3R,4S)-3,6-dihydroxy-2-methyl-3-methylsulfonyloxan-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S,3R,4S)-3,6-dihydroxy-2-methyl-3-methylsulfonyloxan-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 86750394 |
| Molecular Formula | C9H14F3NO6S |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | N-[(2S,3R,4S)-3,6-dihydroxy-2-methyl-3-methylsulfonyloxan-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@@H]1OC(O)C[C@H](NC(=O)C(F)(F)F)[C@@]1(O)S(C)(=O)=O |
| InChI | InChI=1S/C9H14F3NO6S/c1-4-8(16,20(2,17)18)5(3-6(14)19-4)13-7(15)9(10,11)12/h4-6,14,16H,3H2,1-2H3,(H,13,15)/t4-,5-,6?,8-/m0/s1 |
| InChIKey | CBKCSHQKAKOWPM-VYIVRZLYSA-N |
| XLogP | -1.11 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |