C13H15FO2S2 — CID 86750751
S-[(3S,5R)-5-[(4-fluorophenyl)sulfanylmethyl]oxolan-3-yl] ethanethioate (PubChem CID 86750751) has the molecular formula C13H15FO2S2 and a molecular weight of 286.39 g/mol. Its IUPAC name is S-[(3S,5R)-5-[(4-fluorophenyl)sulfanylmethyl]oxolan-3-yl] ethanethioate.
| Compound Name | S-[(3S,5R)-5-[(4-fluorophenyl)sulfanylmethyl]oxolan-3-yl] ethanethioate |
|---|---|
| PubChem CID | 86750751 |
| Molecular Formula | C13H15FO2S2 |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | S-[(3S,5R)-5-[(4-fluorophenyl)sulfanylmethyl]oxolan-3-yl] ethanethioate |
| SMILES | CC(=O)S[C@@H]1CO[C@@H](CSc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C13H15FO2S2/c1-9(15)18-13-6-11(16-7-13)8-17-12-4-2-10(14)3-5-12/h2-5,11,13H,6-8H2,1H3/t11-,13+/m1/s1 |
| InChIKey | RSECRKSURUGRQI-YPMHNXCESA-N |
| XLogP | 3.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|