C24H18O6 — CID 86750782
2-O-(2,6-dimethylphenyl) 1-O-(2-oxo-3-phenyl-3H-1-benzofuran-5-yl) oxalate (PubChem CID 86750782) has the molecular formula C24H18O6 and a molecular weight of 402.40 g/mol. Its IUPAC name is 2-O-(2,6-dimethylphenyl) 1-O-(2-oxo-3-phenyl-3H-1-benzofuran-5-yl) oxalate.
| Compound Name | 2-O-(2,6-dimethylphenyl) 1-O-(2-oxo-3-phenyl-3H-1-benzofuran-5-yl) oxalate |
|---|---|
| PubChem CID | 86750782 |
| Molecular Formula | C24H18O6 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 2-O-(2,6-dimethylphenyl) 1-O-(2-oxo-3-phenyl-3H-1-benzofuran-5-yl) oxalate |
| SMILES | Cc1cccc(C)c1OC(=O)C(=O)Oc1ccc2c(c1)C(c1ccccc1)C(=O)O2 |
| InChI | InChI=1S/C24H18O6/c1-14-7-6-8-15(2)21(14)30-24(27)23(26)28-17-11-12-19-18(13-17)20(22(25)29-19)16-9-4-3-5-10-16/h3-13,20H,1-2H3 |
| InChIKey | SKSGROTYVSBNFX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|