C29H34N2O8S2 — CID 86750984
2-[2,6-dimethoxy-4-[(2S,4S)-2-(3,4,5-trimethoxyphenyl)-1,3-dithiolan-4-yl]phenoxy]ethyl N-(pyridin-2-ylmethyl)carbamate (PubChem CID 86750984) has the molecular formula C29H34N2O8S2 and a molecular weight of 602.73 g/mol. Its IUPAC name is 2-[2,6-dimethoxy-4-[(2S,4S)-2-(3,4,5-trimethoxyphenyl)-1,3-dithiolan-4-yl]phenoxy]ethyl N-(pyridin-2-ylmethyl)carbamate.
| Compound Name | 2-[2,6-dimethoxy-4-[(2S,4S)-2-(3,4,5-trimethoxyphenyl)-1,3-dithiolan-4-yl]phenoxy]ethyl N-(pyridin-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 86750984 |
| Molecular Formula | C29H34N2O8S2 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | 2-[2,6-dimethoxy-4-[(2S,4S)-2-(3,4,5-trimethoxyphenyl)-1,3-dithiolan-4-yl]phenoxy]ethyl N-(pyridin-2-ylmethyl)carbamate |
| SMILES | COc1cc([C@H]2SC[C@H](c3cc(OC)c(OCCOC(=O)NCc4ccccn4)c(OC)c3)S2)cc(OC)c1OC |
| InChI | InChI=1S/C29H34N2O8S2/c1-33-21-14-19(15-22(34-2)26(21)37-5)28-40-17-25(41-28)18-12-23(35-3)27(24(13-18)36-4)38-10-11-39-29(32)31-16-20-8-6-7-9-30-20/h6-9,12-15,25,28H,10-11,16-17H2,1-5H3,(H,31,32)/t25-,28+/m1/s1 |
| InChIKey | GSHZMLOPUWXZPV-NAKRPHOHSA-N |
| XLogP | 5.65 |
| TPSA | 106.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|