C39H35N3O5S — CID 86751800
5-[[4-[2-[(6-ethoxy-3-pyridinyl)methylideneamino]oxyethoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione (PubChem CID 86751800) has the molecular formula C39H35N3O5S and a molecular weight of 657.79 g/mol. Its IUPAC name is 5-[[4-[2-[(6-ethoxy-3-pyridinyl)methylideneamino]oxyethoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-[(6-ethoxy-3-pyridinyl)methylideneamino]oxyethoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 86751800 |
| Molecular Formula | C39H35N3O5S |
| Molecular Weight | 657.79 g/mol |
| Exact Mass | 657.23 |
| IUPAC Name | 5-[[4-[2-[(6-ethoxy-3-pyridinyl)methylideneamino]oxyethoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1ccc(C=NOCCOc2ccc(CC3SC(=O)N(C(c4ccccc4)(c4ccccc4)c4ccccc4)C3=O)cc2)cn1 |
| InChI | InChI=1S/C39H35N3O5S/c1-2-45-36-23-20-30(27-40-36)28-41-47-25-24-46-34-21-18-29(19-22-34)26-35-37(43)42(38(44)48-35)39(31-12-6-3-7-13-31,32-14-8-4-9-15-32)33-16-10-5-11-17-33/h3-23,27-28,35H,2,24-26H2,1H3 |
| InChIKey | DUIBYFYNPOQAQS-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 90.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.79 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|