C12H17FN4O3S — CID 86752023
[(7R,8aS)-2-(5-fluoropyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl] methanesulfonate (PubChem CID 86752023) has the molecular formula C12H17FN4O3S and a molecular weight of 316.36 g/mol. Its IUPAC name is [(7R,8aS)-2-(5-fluoropyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl] methanesulfonate.
| Compound Name | [(7R,8aS)-2-(5-fluoropyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 86752023 |
| Molecular Formula | C12H17FN4O3S |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | [(7R,8aS)-2-(5-fluoropyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1C[C@H]2CN(c3ncc(F)cn3)CCN2C1 |
| InChI | InChI=1S/C12H17FN4O3S/c1-21(18,19)20-11-4-10-7-17(3-2-16(10)8-11)12-14-5-9(13)6-15-12/h5-6,10-11H,2-4,7-8H2,1H3/t10-,11+/m0/s1 |
| InChIKey | VPZAUECHJCLODB-WDEREUQCSA-N |
| XLogP | -0.15 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|