About 8-(4-hydroxybutyl)-4H-thieno[3,2-c][1]benzoxepin-10-one;methanesulfonic acid
8-(4-hydroxybutyl)-4H-thieno[3,2-c][1]benzoxepin-10-one;methanesulfonic acid (PubChem CID 86753361) has the molecular formula C17H20O6S2
and a molecular weight of 384.48 g/mol. Its IUPAC name is 8-(4-hydroxybutyl)-4H-thieno[3,2-c][1]benzoxepin-10-one;methanesulfonic acid.
Molecular Properties
| Compound Name | 8-(4-hydroxybutyl)-4H-thieno[3,2-c][1]benzoxepin-10-one;methanesulfonic acid |
| PubChem CID | 86753361 |
| Molecular Formula | C17H20O6S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 8-(4-hydroxybutyl)-4H-thieno[3,2-c][1]benzoxepin-10-one;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.O=C1c2cc(CCCCO)ccc2OCc2ccsc21 |
| InChI | InChI=1S/C16H16O3S.CH4O3S/c17-7-2-1-3-11-4-5-14-13(9-11)15(18)16-12(10-19-14)6-8-20-16;1-5(2,3)4/h4-6,8-9,17H,1-3,7,10H2;1H3,(H,2,3,4) |
| InChIKey | OYBHCZYKNFQNLT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 8-(4-hydroxybutyl)-4H-thieno[3,2-c][1]benzoxepin-10-one;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-hydroxybutyl)-4H-thieno[3,2-c][1]benzoxepin-10-one;methanesulfonic acid?
The IUPAC name of 8-(4-hydroxybutyl)-4H-thieno[3,2-c][1]benzoxepin-10-one;methanesulfonic acid (CID 86753361) is 8-(4-hydroxybutyl)-4H-thieno[3,2-c][1]benzoxepin-10-one;methanesulfonic acid.
What is the SMILES notation for 8-(4-hydroxybutyl)-4H-thieno[3,2-c][1]benzoxepin-10-one;methanesulfonic acid?
The canonical SMILES for 8-(4-hydroxybutyl)-4H-thieno[3,2-c][1]benzoxepin-10-one;methanesulfonic acid is CS(=O)(=O)O.O=C1c2cc(CCCCO)ccc2OCc2ccsc21.
What is the InChIKey of 8-(4-hydroxybutyl)-4H-thieno[3,2-c][1]benzoxepin-10-one;methanesulfonic acid?
The InChIKey is OYBHCZYKNFQNLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O3S.CH4O3S/c17-7-2-1-3-11-4-5-14-13(9-11)15(18)16-12(10-19-14)6-8-20-16;1-5(2,3)4/h4-6,8-9,17H,1-3,7,10H2;1H3,(H,2,3,4).
What are the key properties of 8-(4-hydroxybutyl)-4H-thieno[3,2-c][1]benzoxepin-10-one;methanesulfonic acid?
8-(4-hydroxybutyl)-4H-thieno[3,2-c][1]benzoxepin-10-one;methanesulfonic acid has a molecular weight of 384.48 g/mol, XLogP of 2.69, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-hydroxybutyl)-4H-thieno[3,2-c][1]benzoxepin-10-one;methanesulfonic acid is sourced from PubChem (CID 86753361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).