About (7-chloro-6-fluoro-2,3-dimethoxyquinoxalin-5-yl)methanesulfonamide
(7-chloro-6-fluoro-2,3-dimethoxyquinoxalin-5-yl)methanesulfonamide (PubChem CID 86753465) has the molecular formula C11H11ClFN3O4S
and a molecular weight of 335.74 g/mol. Its IUPAC name is (7-chloro-6-fluoro-2,3-dimethoxyquinoxalin-5-yl)methanesulfonamide.
Molecular Properties
| Compound Name | (7-chloro-6-fluoro-2,3-dimethoxyquinoxalin-5-yl)methanesulfonamide |
| PubChem CID | 86753465 |
| Molecular Formula | C11H11ClFN3O4S |
| Molecular Weight | 335.74 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | (7-chloro-6-fluoro-2,3-dimethoxyquinoxalin-5-yl)methanesulfonamide |
| SMILES | COc1nc2cc(Cl)c(F)c(CS(N)(=O)=O)c2nc1OC |
| InChI | InChI=1S/C11H11ClFN3O4S/c1-19-10-11(20-2)16-9-5(4-21(14,17)18)8(13)6(12)3-7(9)15-10/h3H,4H2,1-2H3,(H2,14,17,18) |
| InChIKey | CNJKOYRBHBKFLI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.74 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (7-chloro-6-fluoro-2,3-dimethoxyquinoxalin-5-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-chloro-6-fluoro-2,3-dimethoxyquinoxalin-5-yl)methanesulfonamide?
The IUPAC name of (7-chloro-6-fluoro-2,3-dimethoxyquinoxalin-5-yl)methanesulfonamide (CID 86753465) is (7-chloro-6-fluoro-2,3-dimethoxyquinoxalin-5-yl)methanesulfonamide.
What is the SMILES notation for (7-chloro-6-fluoro-2,3-dimethoxyquinoxalin-5-yl)methanesulfonamide?
The canonical SMILES for (7-chloro-6-fluoro-2,3-dimethoxyquinoxalin-5-yl)methanesulfonamide is COc1nc2cc(Cl)c(F)c(CS(N)(=O)=O)c2nc1OC.
What is the InChIKey of (7-chloro-6-fluoro-2,3-dimethoxyquinoxalin-5-yl)methanesulfonamide?
The InChIKey is CNJKOYRBHBKFLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClFN3O4S/c1-19-10-11(20-2)16-9-5(4-21(14,17)18)8(13)6(12)3-7(9)15-10/h3H,4H2,1-2H3,(H2,14,17,18).
What are the key properties of (7-chloro-6-fluoro-2,3-dimethoxyquinoxalin-5-yl)methanesulfonamide?
(7-chloro-6-fluoro-2,3-dimethoxyquinoxalin-5-yl)methanesulfonamide has a molecular weight of 335.74 g/mol, XLogP of 1.23, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (7-chloro-6-fluoro-2,3-dimethoxyquinoxalin-5-yl)methanesulfonamide is sourced from PubChem (CID 86753465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).