C17H13ClN4OS — CID 86753954
(7S)-5-[4-(chloromethyl)-1,3-thiazol-2-yl]-2,4,10-triazatetracyclo[10.4.0.02,6.07,10]hexadeca-1(16),3,5,12,14-pentaen-11-one (PubChem CID 86753954) has the molecular formula C17H13ClN4OS and a molecular weight of 356.84 g/mol. Its IUPAC name is (7S)-5-[4-(chloromethyl)-1,3-thiazol-2-yl]-2,4,10-triazatetracyclo[10.4.0.02,6.07,10]hexadeca-1(16),3,5,12,14-pentaen-11-one.
| Compound Name | (7S)-5-[4-(chloromethyl)-1,3-thiazol-2-yl]-2,4,10-triazatetracyclo[10.4.0.02,6.07,10]hexadeca-1(16),3,5,12,14-pentaen-11-one |
|---|---|
| PubChem CID | 86753954 |
| Molecular Formula | C17H13ClN4OS |
| Molecular Weight | 356.84 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | (7S)-5-[4-(chloromethyl)-1,3-thiazol-2-yl]-2,4,10-triazatetracyclo[10.4.0.02,6.07,10]hexadeca-1(16),3,5,12,14-pentaen-11-one |
| SMILES | O=C1c2ccccc2-n2cnc(-c3nc(CCl)cs3)c2[C@@H]2CCN12 |
| InChI | InChI=1S/C17H13ClN4OS/c18-7-10-8-24-16(20-10)14-15-13-5-6-21(13)17(23)11-3-1-2-4-12(11)22(15)9-19-14/h1-4,8-9,13H,5-7H2/t13-/m0/s1 |
| InChIKey | BVIPLYMXGBFJPM-ZDUSSCGKSA-N |
| XLogP | 3.64 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.84 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|