C22H24ClN3O4S — CID 86753979
5-[[4-[(5-hydroxy-1,4,6,7-tetramethylbenzimidazol-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride (PubChem CID 86753979) has the molecular formula C22H24ClN3O4S and a molecular weight of 461.97 g/mol. Its IUPAC name is 5-[[4-[(5-hydroxy-1,4,6,7-tetramethylbenzimidazol-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride.
| Compound Name | 5-[[4-[(5-hydroxy-1,4,6,7-tetramethylbenzimidazol-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 86753979 |
| Molecular Formula | C22H24ClN3O4S |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 5-[[4-[(5-hydroxy-1,4,6,7-tetramethylbenzimidazol-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride |
| SMILES | Cc1c(O)c(C)c2nc(COc3ccc(CC4SC(=O)NC4=O)cc3)n(C)c2c1C.Cl |
| InChI | InChI=1S/C22H23N3O4S.ClH/c1-11-12(2)20(26)13(3)18-19(11)25(4)17(23-18)10-29-15-7-5-14(6-8-15)9-16-21(27)24-22(28)30-16;/h5-8,16,26H,9-10H2,1-4H3,(H,24,27,28);1H |
| InChIKey | KOQFXKOOKRITFW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|