About CID 86754167
CID 86754167 (PubChem CID 86754167) has the molecular formula C16H20BN2O2
and a molecular weight of 283.16 g/mol.
Molecular Properties
| Compound Name | CID 86754167 |
| PubChem CID | 86754167 |
| Molecular Formula | C16H20BN2O2 |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | — |
| SMILES | N#CCc1ccc(OCC2(O)CN3CCC2CC3)cc1.[B] |
| InChI | InChI=1S/C16H20N2O2.B/c17-8-5-13-1-3-15(4-2-13)20-12-16(19)11-18-9-6-14(16)7-10-18;/h1-4,14,19H,5-7,9-12H2; |
| InChIKey | ZZVSQJAIQRUBNY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 86754167 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 86754167?
The IUPAC name of CID 86754167 (CID 86754167) is not available.
What is the SMILES notation for CID 86754167?
The canonical SMILES for CID 86754167 is N#CCc1ccc(OCC2(O)CN3CCC2CC3)cc1.[B].
What is the InChIKey of CID 86754167?
The InChIKey is ZZVSQJAIQRUBNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O2.B/c17-8-5-13-1-3-15(4-2-13)20-12-16(19)11-18-9-6-14(16)7-10-18;/h1-4,14,19H,5-7,9-12H2;.
What are the key properties of CID 86754167?
CID 86754167 has a molecular weight of 283.16 g/mol, XLogP of 1.21, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 86754167 is sourced from PubChem (CID 86754167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).