C11H9N3 — CID 86754514
5H-pyrido[2,3-b]indol-4-amine (PubChem CID 86754514) has the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 5H-pyrido[2,3-b]indol-4-amine.
| Compound Name | 5H-pyrido[2,3-b]indol-4-amine |
|---|---|
| PubChem CID | 86754514 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 5H-pyrido[2,3-b]indol-4-amine |
| SMILES | Nc1ccnc2c1=C1CC=CC=C1N=2 |
| InChI | InChI=1S/C11H9N3/c12-8-5-6-13-11-10(8)7-3-1-2-4-9(7)14-11/h1-2,4-6H,3,12H2 |
| InChIKey | HFMDMKZEHUIXRO-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |