About 5H-pyrido[2,3-b]indol-4-amine
5H-pyrido[2,3-b]indol-4-amine (PubChem CID 86754514) has the molecular formula C11H9N3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 5H-pyrido[2,3-b]indol-4-amine.
Molecular Properties
| Compound Name | 5H-pyrido[2,3-b]indol-4-amine |
| PubChem CID | 86754514 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 5H-pyrido[2,3-b]indol-4-amine |
| SMILES | Nc1ccnc2c1=C1CC=CC=C1N=2 |
| InChI | InChI=1S/C11H9N3/c12-8-5-6-13-11-10(8)7-3-1-2-4-9(7)14-11/h1-2,4-6H,3,12H2 |
| InChIKey | HFMDMKZEHUIXRO-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5H-pyrido[2,3-b]indol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrido[2,3-b]indol-4-amine?
The IUPAC name of 5H-pyrido[2,3-b]indol-4-amine (CID 86754514) is 5H-pyrido[2,3-b]indol-4-amine.
What is the SMILES notation for 5H-pyrido[2,3-b]indol-4-amine?
The canonical SMILES for 5H-pyrido[2,3-b]indol-4-amine is Nc1ccnc2c1=C1CC=CC=C1N=2.
What is the InChIKey of 5H-pyrido[2,3-b]indol-4-amine?
The InChIKey is HFMDMKZEHUIXRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3/c12-8-5-6-13-11-10(8)7-3-1-2-4-9(7)14-11/h1-2,4-6H,3,12H2.
What are the key properties of 5H-pyrido[2,3-b]indol-4-amine?
5H-pyrido[2,3-b]indol-4-amine has a molecular weight of 183.21 g/mol, XLogP of 0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrido[2,3-b]indol-4-amine is sourced from PubChem (CID 86754514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).