C15H16Cl2N2O — CID 86754896
N-[(1S,3S,4S,8R)-3-(3,4-dichlorophenyl)-7-azatricyclo[5.3.0.04,8]decan-5-ylidene]hydroxylamine (PubChem CID 86754896) has the molecular formula C15H16Cl2N2O and a molecular weight of 311.21 g/mol. Its IUPAC name is N-[(1S,3S,4S,8R)-3-(3,4-dichlorophenyl)-7-azatricyclo[5.3.0.04,8]decan-5-ylidene]hydroxylamine.
| Compound Name | N-[(1S,3S,4S,8R)-3-(3,4-dichlorophenyl)-7-azatricyclo[5.3.0.04,8]decan-5-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 86754896 |
| Molecular Formula | C15H16Cl2N2O |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-[(1S,3S,4S,8R)-3-(3,4-dichlorophenyl)-7-azatricyclo[5.3.0.04,8]decan-5-ylidene]hydroxylamine |
| SMILES | ON=C1CN2[C@H]3CC[C@@H]2[C@@H]1[C@@H](c1ccc(Cl)c(Cl)c1)C3 |
| InChI | InChI=1S/C15H16Cl2N2O/c16-11-3-1-8(5-12(11)17)10-6-9-2-4-14-15(10)13(18-20)7-19(9)14/h1,3,5,9-10,14-15,20H,2,4,6-7H2/t9-,10+,14+,15+/m0/s1 |
| InChIKey | AXDGAGCMDRTNFA-UNNXFLIFSA-N |
| XLogP | 3.77 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|