C25H36O3 — CID 86756399
(2S,5S)-2-[(E)-but-2-enoxy]-5-[4-(4-propyl-1-bicyclo[2.2.2]octanyl)phenyl]-1,4-dioxane (PubChem CID 86756399) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is (2S,5S)-2-[(E)-but-2-enoxy]-5-[4-(4-propyl-1-bicyclo[2.2.2]octanyl)phenyl]-1,4-dioxane.
| Compound Name | (2S,5S)-2-[(E)-but-2-enoxy]-5-[4-(4-propyl-1-bicyclo[2.2.2]octanyl)phenyl]-1,4-dioxane |
|---|---|
| PubChem CID | 86756399 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | (2S,5S)-2-[(E)-but-2-enoxy]-5-[4-(4-propyl-1-bicyclo[2.2.2]octanyl)phenyl]-1,4-dioxane |
| SMILES | C/C=C/CO[C@@H]1CO[C@@H](c2ccc(C34CCC(CCC)(CC3)CC4)cc2)CO1 |
| InChI | InChI=1S/C25H36O3/c1-3-5-17-26-23-19-27-22(18-28-23)20-6-8-21(9-7-20)25-14-11-24(10-4-2,12-15-25)13-16-25/h3,5-9,22-23H,4,10-19H2,1-2H3/b5-3+/t22-,23+,24?,25?/m1/s1 |
| InChIKey | PFXKSATZWXWUHG-AUNNLMIXSA-N |
| XLogP | 6.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|