C16H14N2O9S2 — CID 86756413
4-methylsulfanyl-3-nitrobenzoic acid;4-methylsulfinyl-3-nitrobenzoic acid (PubChem CID 86756413) has the molecular formula C16H14N2O9S2 and a molecular weight of 442.43 g/mol. Its IUPAC name is 4-methylsulfanyl-3-nitrobenzoic acid;4-methylsulfinyl-3-nitrobenzoic acid.
| Compound Name | 4-methylsulfanyl-3-nitrobenzoic acid;4-methylsulfinyl-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 86756413 |
| Molecular Formula | C16H14N2O9S2 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | 4-methylsulfanyl-3-nitrobenzoic acid;4-methylsulfinyl-3-nitrobenzoic acid |
| SMILES | CS(=O)c1ccc(C(=O)O)cc1[N+](=O)[O-].CSc1ccc(C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7NO5S.C8H7NO4S/c1-15(14)7-3-2-5(8(10)11)4-6(7)9(12)13;1-14-7-3-2-5(8(10)11)4-6(7)9(12)13/h2-4H,1H3,(H,10,11);2-4H,1H3,(H,10,11) |
| InChIKey | NCMKYWCCCCLUJP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 177.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|