About 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;7-oxabicyclo[4.1.0]heptane-3-carboxylic acid
2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;7-oxabicyclo[4.1.0]heptane-3-carboxylic acid (PubChem CID 86756537) has the molecular formula C16H30O7
and a molecular weight of 334.41 g/mol. Its IUPAC name is 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;7-oxabicyclo[4.1.0]heptane-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;7-oxabicyclo[4.1.0]heptane-3-carboxylic acid |
| PubChem CID | 86756537 |
| Molecular Formula | C16H30O7 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;7-oxabicyclo[4.1.0]heptane-3-carboxylic acid |
| SMILES | CC(O)COC(C)COC(C)CO.O=C(O)C1CCC2OC2C1 |
| InChI | InChI=1S/C9H20O4.C7H10O3/c1-7(11)5-12-9(3)6-13-8(2)4-10;8-7(9)4-1-2-5-6(3-4)10-5/h7-11H,4-6H2,1-3H3;4-6H,1-3H2,(H,8,9) |
| InChIKey | FVYXOGUSFRYHLL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;7-oxabicyclo[4.1.0]heptane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;7-oxabicyclo[4.1.0]heptane-3-carboxylic acid?
The IUPAC name of 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;7-oxabicyclo[4.1.0]heptane-3-carboxylic acid (CID 86756537) is 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;7-oxabicyclo[4.1.0]heptane-3-carboxylic acid.
What is the SMILES notation for 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;7-oxabicyclo[4.1.0]heptane-3-carboxylic acid?
The canonical SMILES for 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;7-oxabicyclo[4.1.0]heptane-3-carboxylic acid is CC(O)COC(C)COC(C)CO.O=C(O)C1CCC2OC2C1.
What is the InChIKey of 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;7-oxabicyclo[4.1.0]heptane-3-carboxylic acid?
The InChIKey is FVYXOGUSFRYHLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O4.C7H10O3/c1-7(11)5-12-9(3)6-13-8(2)4-10;8-7(9)4-1-2-5-6(3-4)10-5/h7-11H,4-6H2,1-3H3;4-6H,1-3H2,(H,8,9).
What are the key properties of 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;7-oxabicyclo[4.1.0]heptane-3-carboxylic acid?
2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;7-oxabicyclo[4.1.0]heptane-3-carboxylic acid has a molecular weight of 334.41 g/mol, XLogP of 0.81, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;7-oxabicyclo[4.1.0]heptane-3-carboxylic acid is sourced from PubChem (CID 86756537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).