C24H19ClF3N3O4S — CID 86756606
1-[[12-chloro-13-(4-methoxyphenyl)-5-(2,2,2-trifluoroacetyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 86756606) has the molecular formula C24H19ClF3N3O4S and a molecular weight of 537.95 g/mol. Its IUPAC name is 1-[[12-chloro-13-(4-methoxyphenyl)-5-(2,2,2-trifluoroacetyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[12-chloro-13-(4-methoxyphenyl)-5-(2,2,2-trifluoroacetyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 86756606 |
| Molecular Formula | C24H19ClF3N3O4S |
| Molecular Weight | 537.95 g/mol |
| Exact Mass | 537.07 |
| IUPAC Name | 1-[[12-chloro-13-(4-methoxyphenyl)-5-(2,2,2-trifluoroacetyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(-c2c(Cl)c(CN3C(=O)CCC3=O)nc3sc4c(c23)CCN(C(=O)C(F)(F)F)C4)cc1 |
| InChI | InChI=1S/C24H19ClF3N3O4S/c1-35-13-4-2-12(3-5-13)19-20-14-8-9-30(23(34)24(26,27)28)11-16(14)36-22(20)29-15(21(19)25)10-31-17(32)6-7-18(31)33/h2-5H,6-11H2,1H3 |
| InChIKey | PZHJIHALJMCTDP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.95 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|