C19H19F3N2O7S — CID 86756631
[4-[(4-methoxyphenyl)methoxy]-3-nitro-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-2-yl] trifluoromethanesulfonate (PubChem CID 86756631) has the molecular formula C19H19F3N2O7S and a molecular weight of 476.43 g/mol. Its IUPAC name is [4-[(4-methoxyphenyl)methoxy]-3-nitro-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-2-yl] trifluoromethanesulfonate.
| Compound Name | [4-[(4-methoxyphenyl)methoxy]-3-nitro-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86756631 |
| Molecular Formula | C19H19F3N2O7S |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | [4-[(4-methoxyphenyl)methoxy]-3-nitro-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-2-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(COc2c3c(nc(OS(=O)(=O)C(F)(F)F)c2[N+](=O)[O-])CCCCC3)cc1 |
| InChI | InChI=1S/C19H19F3N2O7S/c1-29-13-9-7-12(8-10-13)11-30-17-14-5-3-2-4-6-15(14)23-18(16(17)24(25)26)31-32(27,28)19(20,21)22/h7-10H,2-6,11H2,1H3 |
| InChIKey | ROHJHZUNTLOZHX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 117.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|