About (6-aminohexylamino) acetate
(6-aminohexylamino) acetate (PubChem CID 86757233) has the molecular formula C8H18N2O2
and a molecular weight of 174.24 g/mol. Its IUPAC name is (6-aminohexylamino) acetate.
Molecular Properties
| Compound Name | (6-aminohexylamino) acetate |
| PubChem CID | 86757233 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | (6-aminohexylamino) acetate |
| SMILES | CC(=O)ONCCCCCCN |
| InChI | InChI=1S/C8H18N2O2/c1-8(11)12-10-7-5-3-2-4-6-9/h10H,2-7,9H2,1H3 |
| InChIKey | XQBVFQGLSLCOIT-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6-aminohexylamino) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-aminohexylamino) acetate?
The IUPAC name of (6-aminohexylamino) acetate (CID 86757233) is (6-aminohexylamino) acetate.
What is the SMILES notation for (6-aminohexylamino) acetate?
The canonical SMILES for (6-aminohexylamino) acetate is CC(=O)ONCCCCCCN.
What is the InChIKey of (6-aminohexylamino) acetate?
The InChIKey is XQBVFQGLSLCOIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2/c1-8(11)12-10-7-5-3-2-4-6-9/h10H,2-7,9H2,1H3.
What are the key properties of (6-aminohexylamino) acetate?
(6-aminohexylamino) acetate has a molecular weight of 174.24 g/mol, XLogP of 0.57, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-aminohexylamino) acetate is sourced from PubChem (CID 86757233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).