C11H15ClINO2 — CID 86757400
methyl (2S,3R)-2-amino-3-(4-iodophenyl)butanoate;hydrochloride (PubChem CID 86757400) has the molecular formula C11H15ClINO2 and a molecular weight of 355.60 g/mol. Its IUPAC name is methyl (2S,3R)-2-amino-3-(4-iodophenyl)butanoate;hydrochloride.
| Compound Name | methyl (2S,3R)-2-amino-3-(4-iodophenyl)butanoate;hydrochloride |
|---|---|
| PubChem CID | 86757400 |
| Molecular Formula | C11H15ClINO2 |
| Molecular Weight | 355.60 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | methyl (2S,3R)-2-amino-3-(4-iodophenyl)butanoate;hydrochloride |
| SMILES | COC(=O)[C@@H](N)[C@H](C)c1ccc(I)cc1.Cl |
| InChI | InChI=1S/C11H14INO2.ClH/c1-7(10(13)11(14)15-2)8-3-5-9(12)6-4-8;/h3-7,10H,13H2,1-2H3;1H/t7-,10+;/m1./s1 |
| InChIKey | ILOAWXNBMAJHPF-QJVKKXMWSA-N |
| XLogP | 2.32 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.60 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|