C22H18F2N5OS+ — CID 86757479
4-[2-[(2R,3R)-3-(2,5-difluorophenyl)-3-hydroxy-4-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-yl]-1,3-thiazol-4-yl]benzonitrile (PubChem CID 86757479) has the molecular formula C22H18F2N5OS+ and a molecular weight of 438.48 g/mol. Its IUPAC name is 4-[2-[(2R,3R)-3-(2,5-difluorophenyl)-3-hydroxy-4-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-yl]-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 4-[2-[(2R,3R)-3-(2,5-difluorophenyl)-3-hydroxy-4-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-yl]-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 86757479 |
| Molecular Formula | C22H18F2N5OS+ |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 4-[2-[(2R,3R)-3-(2,5-difluorophenyl)-3-hydroxy-4-(1H-1,2,4-triazol-2-ium-2-yl)butan-2-yl]-1,3-thiazol-4-yl]benzonitrile |
| SMILES | C[C@@H](c1nc(-c2ccc(C#N)cc2)cs1)[C@](O)(C[n+]1cnc[nH]1)c1cc(F)ccc1F |
| InChI | InChI=1S/C22H17F2N5OS/c1-14(21-28-20(10-31-21)16-4-2-15(9-25)3-5-16)22(30,11-29-13-26-12-27-29)18-8-17(23)6-7-19(18)24/h2-8,10,12-14,30H,11H2,1H3/p+1/t14-,22+/m0/s1 |
| InChIKey | DDFOUSQFMYRUQK-RCDICMHDSA-O |
| XLogP | 3.66 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|