C28H26F5NO3 — CID 86757590
(3R,4S)-3-(2,3,4,5,6-pentafluorophenyl)-4-[4-(2-piperidin-1-ylethoxy)phenyl]-3,4-dihydro-2H-chromen-7-ol (PubChem CID 86757590) has the molecular formula C28H26F5NO3 and a molecular weight of 519.51 g/mol. Its IUPAC name is (3R,4S)-3-(2,3,4,5,6-pentafluorophenyl)-4-[4-(2-piperidin-1-ylethoxy)phenyl]-3,4-dihydro-2H-chromen-7-ol.
| Compound Name | (3R,4S)-3-(2,3,4,5,6-pentafluorophenyl)-4-[4-(2-piperidin-1-ylethoxy)phenyl]-3,4-dihydro-2H-chromen-7-ol |
|---|---|
| PubChem CID | 86757590 |
| Molecular Formula | C28H26F5NO3 |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | (3R,4S)-3-(2,3,4,5,6-pentafluorophenyl)-4-[4-(2-piperidin-1-ylethoxy)phenyl]-3,4-dihydro-2H-chromen-7-ol |
| SMILES | Oc1ccc2c(c1)OC[C@@H](c1c(F)c(F)c(F)c(F)c1F)[C@H]2c1ccc(OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C28H26F5NO3/c29-24-23(25(30)27(32)28(33)26(24)31)20-15-37-21-14-17(35)6-9-19(21)22(20)16-4-7-18(8-5-16)36-13-12-34-10-2-1-3-11-34/h4-9,14,20,22,35H,1-3,10-13,15H2/t20-,22+/m1/s1 |
| InChIKey | IQLNWUXUUXBPJI-IRLDBZIGSA-N |
| XLogP | 6.26 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|