C34H43NO4Si — CID 86757601
tert-butyl (3S,5S,6R)-2-oxo-5,6-diphenyl-3-[(3-triethylsilylphenyl)methyl]morpholine-4-carboxylate (PubChem CID 86757601) has the molecular formula C34H43NO4Si and a molecular weight of 557.81 g/mol. Its IUPAC name is tert-butyl (3S,5S,6R)-2-oxo-5,6-diphenyl-3-[(3-triethylsilylphenyl)methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (3S,5S,6R)-2-oxo-5,6-diphenyl-3-[(3-triethylsilylphenyl)methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 86757601 |
| Molecular Formula | C34H43NO4Si |
| Molecular Weight | 557.81 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | tert-butyl (3S,5S,6R)-2-oxo-5,6-diphenyl-3-[(3-triethylsilylphenyl)methyl]morpholine-4-carboxylate |
| SMILES | CC[Si](CC)(CC)c1cccc(C[C@H]2C(=O)O[C@H](c3ccccc3)[C@H](c3ccccc3)N2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C34H43NO4Si/c1-7-40(8-2,9-3)28-22-16-17-25(23-28)24-29-32(36)38-31(27-20-14-11-15-21-27)30(26-18-12-10-13-19-26)35(29)33(37)39-34(4,5)6/h10-23,29-31H,7-9,24H2,1-6H3/t29-,30-,31+/m0/s1 |
| InChIKey | OUANYCHEXWXFFQ-RWSKJCERSA-N |
| XLogP | 7.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.81 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|