About 2-[(3,3-dimethylbutanoyloxymethoxycarbonylamino)methyl-hydroxyphosphoryl]oxyacetic acid
2-[(3,3-dimethylbutanoyloxymethoxycarbonylamino)methyl-hydroxyphosphoryl]oxyacetic acid (PubChem CID 86757967) has the molecular formula C11H20NO9P
and a molecular weight of 341.25 g/mol. Its IUPAC name is 2-[(3,3-dimethylbutanoyloxymethoxycarbonylamino)methyl-hydroxyphosphoryl]oxyacetic acid.
Molecular Properties
| Compound Name | 2-[(3,3-dimethylbutanoyloxymethoxycarbonylamino)methyl-hydroxyphosphoryl]oxyacetic acid |
| PubChem CID | 86757967 |
| Molecular Formula | C11H20NO9P |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 2-[(3,3-dimethylbutanoyloxymethoxycarbonylamino)methyl-hydroxyphosphoryl]oxyacetic acid |
| SMILES | CC(C)(C)CC(=O)OCOC(=O)NCP(=O)(O)OCC(=O)O |
| InChI | InChI=1S/C11H20NO9P/c1-11(2,3)4-9(15)19-7-20-10(16)12-6-22(17,18)21-5-8(13)14/h4-7H2,1-3H3,(H,12,16)(H,13,14)(H,17,18) |
| InChIKey | TVVUJKQSFUZBCX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 148.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,3-dimethylbutanoyloxymethoxycarbonylamino)methyl-hydroxyphosphoryl]oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,3-dimethylbutanoyloxymethoxycarbonylamino)methyl-hydroxyphosphoryl]oxyacetic acid?
The IUPAC name of 2-[(3,3-dimethylbutanoyloxymethoxycarbonylamino)methyl-hydroxyphosphoryl]oxyacetic acid (CID 86757967) is 2-[(3,3-dimethylbutanoyloxymethoxycarbonylamino)methyl-hydroxyphosphoryl]oxyacetic acid.
What is the SMILES notation for 2-[(3,3-dimethylbutanoyloxymethoxycarbonylamino)methyl-hydroxyphosphoryl]oxyacetic acid?
The canonical SMILES for 2-[(3,3-dimethylbutanoyloxymethoxycarbonylamino)methyl-hydroxyphosphoryl]oxyacetic acid is CC(C)(C)CC(=O)OCOC(=O)NCP(=O)(O)OCC(=O)O.
What is the InChIKey of 2-[(3,3-dimethylbutanoyloxymethoxycarbonylamino)methyl-hydroxyphosphoryl]oxyacetic acid?
The InChIKey is TVVUJKQSFUZBCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20NO9P/c1-11(2,3)4-9(15)19-7-20-10(16)12-6-22(17,18)21-5-8(13)14/h4-7H2,1-3H3,(H,12,16)(H,13,14)(H,17,18).
What are the key properties of 2-[(3,3-dimethylbutanoyloxymethoxycarbonylamino)methyl-hydroxyphosphoryl]oxyacetic acid?
2-[(3,3-dimethylbutanoyloxymethoxycarbonylamino)methyl-hydroxyphosphoryl]oxyacetic acid has a molecular weight of 341.25 g/mol, XLogP of 0.89, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,3-dimethylbutanoyloxymethoxycarbonylamino)methyl-hydroxyphosphoryl]oxyacetic acid is sourced from PubChem (CID 86757967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).