C39H42FN5O6 — CID 86758222
tert-butyl N-[4-[2-(4-fluorophenyl)ethynyl]-2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]-5-[methyl-[2-(oxan-2-yloxy)ethyl]amino]phenyl]carbamate (PubChem CID 86758222) has the molecular formula C39H42FN5O6 and a molecular weight of 695.79 g/mol. Its IUPAC name is tert-butyl N-[4-[2-(4-fluorophenyl)ethynyl]-2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]-5-[methyl-[2-(oxan-2-yloxy)ethyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-(4-fluorophenyl)ethynyl]-2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]-5-[methyl-[2-(oxan-2-yloxy)ethyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 86758222 |
| Molecular Formula | C39H42FN5O6 |
| Molecular Weight | 695.79 g/mol |
| Exact Mass | 695.31 |
| IUPAC Name | tert-butyl N-[4-[2-(4-fluorophenyl)ethynyl]-2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]-5-[methyl-[2-(oxan-2-yloxy)ethyl]amino]phenyl]carbamate |
| SMILES | CN(CCOC1CCCCO1)c1cc(NC(=O)OC(C)(C)C)c(NC(=O)CC(=O)c2cccc(-n3ccnc3)c2)cc1C#Cc1ccc(F)cc1 |
| InChI | InChI=1S/C39H42FN5O6/c1-39(2,3)51-38(48)43-33-24-34(44(4)19-21-50-37-10-5-6-20-49-37)28(14-11-27-12-15-30(40)16-13-27)23-32(33)42-36(47)25-35(46)29-8-7-9-31(22-29)45-18-17-41-26-45/h7-9,12-13,15-18,22-24,26,37H,5-6,10,19-21,25H2,1-4H3,(H,42,47)(H,43,48) |
| InChIKey | JCCAXMAHEKLSMN-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.79 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|