C11H15N7O2 — CID 86758556
formaldehyde;6-phenyl-1,3,5-triazine-2,4-diamine;urea (PubChem CID 86758556) has the molecular formula C11H15N7O2 and a molecular weight of 277.29 g/mol. Its IUPAC name is formaldehyde;6-phenyl-1,3,5-triazine-2,4-diamine;urea.
| Compound Name | formaldehyde;6-phenyl-1,3,5-triazine-2,4-diamine;urea |
|---|---|
| PubChem CID | 86758556 |
| Molecular Formula | C11H15N7O2 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | formaldehyde;6-phenyl-1,3,5-triazine-2,4-diamine;urea |
| SMILES | C=O.NC(N)=O.Nc1nc(N)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C9H9N5.CH4N2O.CH2O/c10-8-12-7(13-9(11)14-8)6-4-2-1-3-5-6;2-1(3)4;1-2/h1-5H,(H4,10,11,12,13,14);(H4,2,3,4);1H2 |
| InChIKey | WOIRFDMYQLJKAL-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 176.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |