C23H28Cl2F6N2O — CID 86758791
(2S,3S)-N-[[5-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methoxyphenyl]methyl]-2-phenylpiperidin-3-amine;dihydrochloride (PubChem CID 86758791) has the molecular formula C23H28Cl2F6N2O and a molecular weight of 533.38 g/mol. Its IUPAC name is (2S,3S)-N-[[5-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methoxyphenyl]methyl]-2-phenylpiperidin-3-amine;dihydrochloride.
| Compound Name | (2S,3S)-N-[[5-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methoxyphenyl]methyl]-2-phenylpiperidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 86758791 |
| Molecular Formula | C23H28Cl2F6N2O |
| Molecular Weight | 533.38 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | (2S,3S)-N-[[5-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methoxyphenyl]methyl]-2-phenylpiperidin-3-amine;dihydrochloride |
| SMILES | COc1ccc(C(C)(C(F)(F)F)C(F)(F)F)cc1CN[C@H]1CCCN[C@H]1c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C23H26F6N2O.2ClH/c1-21(22(24,25)26,23(27,28)29)17-10-11-19(32-2)16(13-17)14-31-18-9-6-12-30-20(18)15-7-4-3-5-8-15;;/h3-5,7-8,10-11,13,18,20,30-31H,6,9,12,14H2,1-2H3;2*1H/t18-,20-;;/m0../s1 |
| InChIKey | VQWIHYAHJJEAEZ-OINVMNEBSA-N |
| XLogP | 6.50 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.38 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |