C7H8O4 — CID 86758840
1,3,5-trihydroxycyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 86758840) has the molecular formula C7H8O4 and a molecular weight of 156.14 g/mol. Its IUPAC name is 1,3,5-trihydroxycyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 1,3,5-trihydroxycyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 86758840 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 1,3,5-trihydroxycyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | O=CC1(O)C=C(O)C=C(O)C1 |
| InChI | InChI=1S/C7H8O4/c8-4-7(11)2-5(9)1-6(10)3-7/h1-2,4,9-11H,3H2 |
| InChIKey | CYXXZUZJYBGRBH-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|