C17H21F9O2 — CID 86759368
ethyl 4-(5,5,6,6,7,7,8,8,8-nonafluorooctyl)cyclohex-3-ene-1-carboxylate (PubChem CID 86759368) has the molecular formula C17H21F9O2 and a molecular weight of 428.34 g/mol. Its IUPAC name is ethyl 4-(5,5,6,6,7,7,8,8,8-nonafluorooctyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 4-(5,5,6,6,7,7,8,8,8-nonafluorooctyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 86759368 |
| Molecular Formula | C17H21F9O2 |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | ethyl 4-(5,5,6,6,7,7,8,8,8-nonafluorooctyl)cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1CC=C(CCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H21F9O2/c1-2-28-13(27)12-8-6-11(7-9-12)5-3-4-10-14(18,19)15(20,21)16(22,23)17(24,25)26/h6,12H,2-5,7-10H2,1H3 |
| InChIKey | MNTKFXSFKUWNMM-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|