About CID 86759393
CID 86759393 (PubChem CID 86759393) has the molecular formula C34H48F6O4SSi2
and a molecular weight of 722.98 g/mol.
Molecular Properties
| Compound Name | CID 86759393 |
| PubChem CID | 86759393 |
| Molecular Formula | C34H48F6O4SSi2 |
| Molecular Weight | 722.98 g/mol |
| Exact Mass | 722.27 |
| IUPAC Name | — |
| SMILES | CC/C(=C\C=C\C(O)(C(F)(F)F)C(F)(F)F)c1ccc(COc2ccc(C(O[Si](C)C)C(C)(C)C)c(C(O[Si](C)C)C(C)(C)C)c2)s1 |
| InChI | InChI=1S/C34H48F6O4SSi2/c1-12-22(14-13-19-32(41,33(35,36)37)34(38,39)40)27-18-16-24(45-27)21-42-23-15-17-25(28(30(2,3)4)43-46(8)9)26(20-23)29(31(5,6)7)44-47(10)11/h13-20,28-29,41H,12,21H2,1-11H3/b19-13+,22-14+ |
| InChIKey | REUBBRMTBXBVHN-QTLAEQSKSA-N |
| XLogP | 11.24 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 722.98 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 86759393 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 86759393?
The IUPAC name of CID 86759393 (CID 86759393) is not available.
What is the SMILES notation for CID 86759393?
The canonical SMILES for CID 86759393 is CC/C(=C\C=C\C(O)(C(F)(F)F)C(F)(F)F)c1ccc(COc2ccc(C(O[Si](C)C)C(C)(C)C)c(C(O[Si](C)C)C(C)(C)C)c2)s1.
What is the InChIKey of CID 86759393?
The InChIKey is REUBBRMTBXBVHN-QTLAEQSKSA-N. The full InChI is InChI=1S/C34H48F6O4SSi2/c1-12-22(14-13-19-32(41,33(35,36)37)34(38,39)40)27-18-16-24(45-27)21-42-23-15-17-25(28(30(2,3)4)43-46(8)9)26(20-23)29(31(5,6)7)44-47(10)11/h13-20,28-29,41H,12,21H2,1-11H3/b19-13+,22-14+.
What are the key properties of CID 86759393?
CID 86759393 has a molecular weight of 722.98 g/mol, XLogP of 11.24, 13 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 86759393 is sourced from PubChem (CID 86759393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).