About [(1S,2R)-2-[[(1S)-1-cyano-3-methylsulfanylpropyl]carbamoyl]cyclohexyl]azanide
[(1S,2R)-2-[[(1S)-1-cyano-3-methylsulfanylpropyl]carbamoyl]cyclohexyl]azanide (PubChem CID 86759485) has the molecular formula C12H20N3OS-
and a molecular weight of 254.38 g/mol. Its IUPAC name is [(1S,2R)-2-[[(1S)-1-cyano-3-methylsulfanylpropyl]carbamoyl]cyclohexyl]azanide.
Molecular Properties
| Compound Name | [(1S,2R)-2-[[(1S)-1-cyano-3-methylsulfanylpropyl]carbamoyl]cyclohexyl]azanide |
| PubChem CID | 86759485 |
| Molecular Formula | C12H20N3OS- |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | [(1S,2R)-2-[[(1S)-1-cyano-3-methylsulfanylpropyl]carbamoyl]cyclohexyl]azanide |
| SMILES | CSCC[C@@H](C#N)NC(=O)[C@@H]1CCCC[C@@H]1[NH-] |
| InChI | InChI=1S/C12H20N3OS/c1-17-7-6-9(8-13)15-12(16)10-4-2-3-5-11(10)14/h9-11,14H,2-7H2,1H3,(H,15,16)/q-1/t9-,10+,11-/m0/s1 |
| InChIKey | ZVOJSPHKGWSIJK-AXFHLTTASA-N |
| XLogP | 2.36 |
| TPSA | 76.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S,2R)-2-[[(1S)-1-cyano-3-methylsulfanylpropyl]carbamoyl]cyclohexyl]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-[[(1S)-1-cyano-3-methylsulfanylpropyl]carbamoyl]cyclohexyl]azanide?
The IUPAC name of [(1S,2R)-2-[[(1S)-1-cyano-3-methylsulfanylpropyl]carbamoyl]cyclohexyl]azanide (CID 86759485) is [(1S,2R)-2-[[(1S)-1-cyano-3-methylsulfanylpropyl]carbamoyl]cyclohexyl]azanide.
What is the SMILES notation for [(1S,2R)-2-[[(1S)-1-cyano-3-methylsulfanylpropyl]carbamoyl]cyclohexyl]azanide?
The canonical SMILES for [(1S,2R)-2-[[(1S)-1-cyano-3-methylsulfanylpropyl]carbamoyl]cyclohexyl]azanide is CSCC[C@@H](C#N)NC(=O)[C@@H]1CCCC[C@@H]1[NH-].
What is the InChIKey of [(1S,2R)-2-[[(1S)-1-cyano-3-methylsulfanylpropyl]carbamoyl]cyclohexyl]azanide?
The InChIKey is ZVOJSPHKGWSIJK-AXFHLTTASA-N. The full InChI is InChI=1S/C12H20N3OS/c1-17-7-6-9(8-13)15-12(16)10-4-2-3-5-11(10)14/h9-11,14H,2-7H2,1H3,(H,15,16)/q-1/t9-,10+,11-/m0/s1.
What are the key properties of [(1S,2R)-2-[[(1S)-1-cyano-3-methylsulfanylpropyl]carbamoyl]cyclohexyl]azanide?
[(1S,2R)-2-[[(1S)-1-cyano-3-methylsulfanylpropyl]carbamoyl]cyclohexyl]azanide has a molecular weight of 254.38 g/mol, XLogP of 2.36, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-[[(1S)-1-cyano-3-methylsulfanylpropyl]carbamoyl]cyclohexyl]azanide is sourced from PubChem (CID 86759485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).