About 3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethoxybutan-1-amine;hydrochloride
3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethoxybutan-1-amine;hydrochloride (PubChem CID 86759587) has the molecular formula C12H30ClNO3Si
and a molecular weight of 299.92 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethoxybutan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethoxybutan-1-amine;hydrochloride |
| PubChem CID | 86759587 |
| Molecular Formula | C12H30ClNO3Si |
| Molecular Weight | 299.92 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethoxybutan-1-amine;hydrochloride |
| SMILES | COC(OC)C(CCN)O[Si](C)(C)C(C)(C)C.Cl |
| InChI | InChI=1S/C12H29NO3Si.ClH/c1-12(2,3)17(6,7)16-10(8-9-13)11(14-4)15-5;/h10-11H,8-9,13H2,1-7H3;1H |
| InChIKey | UHYGJVKDJNYKMW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.92 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethoxybutan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethoxybutan-1-amine;hydrochloride?
The IUPAC name of 3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethoxybutan-1-amine;hydrochloride (CID 86759587) is 3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethoxybutan-1-amine;hydrochloride.
What is the SMILES notation for 3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethoxybutan-1-amine;hydrochloride?
The canonical SMILES for 3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethoxybutan-1-amine;hydrochloride is COC(OC)C(CCN)O[Si](C)(C)C(C)(C)C.Cl.
What is the InChIKey of 3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethoxybutan-1-amine;hydrochloride?
The InChIKey is UHYGJVKDJNYKMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H29NO3Si.ClH/c1-12(2,3)17(6,7)16-10(8-9-13)11(14-4)15-5;/h10-11H,8-9,13H2,1-7H3;1H.
What are the key properties of 3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethoxybutan-1-amine;hydrochloride?
3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethoxybutan-1-amine;hydrochloride has a molecular weight of 299.92 g/mol, XLogP of 2.77, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethoxybutan-1-amine;hydrochloride is sourced from PubChem (CID 86759587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).