C22H30N4O4S2 — CID 86760123
ethyl 2-[(6-amino-3-pyridinyl)methyl]-3-[[2-[(6-amino-3-pyridinyl)methyl]-3-ethoxy-3-oxopropyl]disulfanyl]propanoate (PubChem CID 86760123) has the molecular formula C22H30N4O4S2 and a molecular weight of 478.64 g/mol. Its IUPAC name is ethyl 2-[(6-amino-3-pyridinyl)methyl]-3-[[2-[(6-amino-3-pyridinyl)methyl]-3-ethoxy-3-oxopropyl]disulfanyl]propanoate.
| Compound Name | ethyl 2-[(6-amino-3-pyridinyl)methyl]-3-[[2-[(6-amino-3-pyridinyl)methyl]-3-ethoxy-3-oxopropyl]disulfanyl]propanoate |
|---|---|
| PubChem CID | 86760123 |
| Molecular Formula | C22H30N4O4S2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | ethyl 2-[(6-amino-3-pyridinyl)methyl]-3-[[2-[(6-amino-3-pyridinyl)methyl]-3-ethoxy-3-oxopropyl]disulfanyl]propanoate |
| SMILES | CCOC(=O)C(CSSCC(Cc1ccc(N)nc1)C(=O)OCC)Cc1ccc(N)nc1 |
| InChI | InChI=1S/C22H30N4O4S2/c1-3-29-21(27)17(9-15-5-7-19(23)25-11-15)13-31-32-14-18(22(28)30-4-2)10-16-6-8-20(24)26-12-16/h5-8,11-12,17-18H,3-4,9-10,13-14H2,1-2H3,(H2,23,25)(H2,24,26) |
| InChIKey | VXUJGQRUHGASJZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 130.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|