C21H12N4O7 — CID 86760191
4-(3,5-dinitrophenyl)-9-methoxy-6H-pyrrolo[3,4-c]carbazole-1,3-dione (PubChem CID 86760191) has the molecular formula C21H12N4O7 and a molecular weight of 432.35 g/mol. Its IUPAC name is 4-(3,5-dinitrophenyl)-9-methoxy-6H-pyrrolo[3,4-c]carbazole-1,3-dione.
| Compound Name | 4-(3,5-dinitrophenyl)-9-methoxy-6H-pyrrolo[3,4-c]carbazole-1,3-dione |
|---|---|
| PubChem CID | 86760191 |
| Molecular Formula | C21H12N4O7 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 4-(3,5-dinitrophenyl)-9-methoxy-6H-pyrrolo[3,4-c]carbazole-1,3-dione |
| SMILES | COc1ccc2[nH]c3cc(-c4cc([N+](=O)[O-])cc([N+](=O)[O-])c4)c4c(c3c2c1)C(=O)NC4=O |
| InChI | InChI=1S/C21H12N4O7/c1-32-12-2-3-15-14(7-12)17-16(22-15)8-13(18-19(17)21(27)23-20(18)26)9-4-10(24(28)29)6-11(5-9)25(30)31/h2-8,22H,1H3,(H,23,26,27) |
| InChIKey | QZGFNIOXHTVXNM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 157.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|