C16H11N3S — CID 867602
2,6-diphenylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 867602) has the molecular formula C16H11N3S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2,6-diphenylimidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 2,6-diphenylimidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 867602 |
| Molecular Formula | C16H11N3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2,6-diphenylimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | c1ccc(-c2cn3nc(-c4ccccc4)sc3n2)cc1 |
| InChI | InChI=1S/C16H11N3S/c1-3-7-12(8-4-1)14-11-19-16(17-14)20-15(18-19)13-9-5-2-6-10-13/h1-11H |
| InChIKey | OAAKEJCQYKVQEU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |