C25H24F3N3O8S — CID 86760426
ethyl 3-[1-[[4-[[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]methyl]-3-(trifluoromethylsulfonyloxy)pyrazol-4-yl]propanoate (PubChem CID 86760426) has the molecular formula C25H24F3N3O8S and a molecular weight of 583.54 g/mol. Its IUPAC name is ethyl 3-[1-[[4-[[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]methyl]-3-(trifluoromethylsulfonyloxy)pyrazol-4-yl]propanoate.
| Compound Name | ethyl 3-[1-[[4-[[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]methyl]-3-(trifluoromethylsulfonyloxy)pyrazol-4-yl]propanoate |
|---|---|
| PubChem CID | 86760426 |
| Molecular Formula | C25H24F3N3O8S |
| Molecular Weight | 583.54 g/mol |
| Exact Mass | 583.12 |
| IUPAC Name | ethyl 3-[1-[[4-[[2-(furan-2-yl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]methyl]-3-(trifluoromethylsulfonyloxy)pyrazol-4-yl]propanoate |
| SMILES | CCOC(=O)CCc1cn(Cc2ccc(OCc3nc(-c4ccco4)oc3C)cc2)nc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C25H24F3N3O8S/c1-3-35-22(32)11-8-18-14-31(30-23(18)39-40(33,34)25(26,27)28)13-17-6-9-19(10-7-17)37-15-20-16(2)38-24(29-20)21-5-4-12-36-21/h4-7,9-10,12,14H,3,8,11,13,15H2,1-2H3 |
| InChIKey | YZFUPTWZLUWBJS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 135.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|