C24H20F9N3O — CID 86761036
1-[(2R,4S)-1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]-3-diazopropan-2-one (PubChem CID 86761036) has the molecular formula C24H20F9N3O and a molecular weight of 537.43 g/mol. Its IUPAC name is 1-[(2R,4S)-1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]-3-diazopropan-2-one.
| Compound Name | 1-[(2R,4S)-1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]-3-diazopropan-2-one |
|---|---|
| PubChem CID | 86761036 |
| Molecular Formula | C24H20F9N3O |
| Molecular Weight | 537.43 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | 1-[(2R,4S)-1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]-3-diazopropan-2-one |
| SMILES | [N-]=[N+]=CC(=O)C[C@H]1CCN(Cc2cc(C(F)(F)F)ccc2C(F)(F)F)[C@@H](c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C24H20F9N3O/c25-22(26,27)17-3-1-15(2-4-17)21-10-14(9-19(37)12-35-34)7-8-36(21)13-16-11-18(23(28,29)30)5-6-20(16)24(31,32)33/h1-6,11-12,14,21H,7-10,13H2/t14-,21-/m1/s1 |
| InChIKey | UHMPQDWMEXQIHO-SPLOXXLWSA-N |
| XLogP | 6.96 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.43 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|