C24H32ClN3O3 — CID 86761108
2-[(1S)-5-[3-[(2-chloro-5-methylpyrimidin-4-yl)-propylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]butanoic acid (PubChem CID 86761108) has the molecular formula C24H32ClN3O3 and a molecular weight of 445.99 g/mol. Its IUPAC name is 2-[(1S)-5-[3-[(2-chloro-5-methylpyrimidin-4-yl)-propylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]butanoic acid.
| Compound Name | 2-[(1S)-5-[3-[(2-chloro-5-methylpyrimidin-4-yl)-propylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]butanoic acid |
|---|---|
| PubChem CID | 86761108 |
| Molecular Formula | C24H32ClN3O3 |
| Molecular Weight | 445.99 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 2-[(1S)-5-[3-[(2-chloro-5-methylpyrimidin-4-yl)-propylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]butanoic acid |
| SMILES | CCCN(CCCOc1ccc2c(c1)CC[C@H]2C(CC)C(=O)O)c1nc(Cl)ncc1C |
| InChI | InChI=1S/C24H32ClN3O3/c1-4-11-28(22-16(3)15-26-24(25)27-22)12-6-13-31-18-8-10-20-17(14-18)7-9-21(20)19(5-2)23(29)30/h8,10,14-15,19,21H,4-7,9,11-13H2,1-3H3,(H,29,30)/t19?,21-/m0/s1 |
| InChIKey | UTBLMHNJLQVTAY-QWAKEFERSA-N |
| XLogP | 5.26 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.99 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|