C13H17F3N2O3 — CID 86761110
4-(1-methylpyrrolidin-3-yl)oxyaniline;2,2,2-trifluoroacetic acid (PubChem CID 86761110) has the molecular formula C13H17F3N2O3 and a molecular weight of 306.28 g/mol. Its IUPAC name is 4-(1-methylpyrrolidin-3-yl)oxyaniline;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(1-methylpyrrolidin-3-yl)oxyaniline;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86761110 |
| Molecular Formula | C13H17F3N2O3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 4-(1-methylpyrrolidin-3-yl)oxyaniline;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCC(Oc2ccc(N)cc2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H16N2O.C2HF3O2/c1-13-7-6-11(8-13)14-10-4-2-9(12)3-5-10;3-2(4,5)1(6)7/h2-5,11H,6-8,12H2,1H3;(H,6,7) |
| InChIKey | ZQXWNUUZAAUMCY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|