C21H24F3N5O4 — CID 86761277
tert-butyl N-[(3R,4R)-1-(6-amino-5-nitro-2-pyridinyl)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate (PubChem CID 86761277) has the molecular formula C21H24F3N5O4 and a molecular weight of 467.45 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R)-1-(6-amino-5-nitro-2-pyridinyl)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R)-1-(6-amino-5-nitro-2-pyridinyl)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 86761277 |
| Molecular Formula | C21H24F3N5O4 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | tert-butyl N-[(3R,4R)-1-(6-amino-5-nitro-2-pyridinyl)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CN(c2ccc([N+](=O)[O-])c(N)n2)CC[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H24F3N5O4/c1-21(2,3)33-20(30)26-16-10-28(18-5-4-17(29(31)32)19(25)27-18)7-6-11(16)12-8-14(23)15(24)9-13(12)22/h4-5,8-9,11,16H,6-7,10H2,1-3H3,(H2,25,27)(H,26,30)/t11-,16+/m1/s1 |
| InChIKey | FEQWIWJTNXLLRO-BZNIZROVSA-N |
| XLogP | 3.88 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|