C21H20FN3O2S — CID 8676149
1-(3-fluorophenyl)-2-[[5-[(3-methylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 8676149) has the molecular formula C21H20FN3O2S and a molecular weight of 397.48 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-2-[[5-[(3-methylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-(3-fluorophenyl)-2-[[5-[(3-methylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 8676149 |
| Molecular Formula | C21H20FN3O2S |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 1-(3-fluorophenyl)-2-[[5-[(3-methylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | C=CCn1c(COc2cccc(C)c2)nnc1SCC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C21H20FN3O2S/c1-3-10-25-20(13-27-18-9-4-6-15(2)11-18)23-24-21(25)28-14-19(26)16-7-5-8-17(22)12-16/h3-9,11-12H,1,10,13-14H2,2H3 |
| InChIKey | SWMDEQBAJWUWEC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|