C7H6F7NS — CID 86761605
2-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfanylacetonitrile (PubChem CID 86761605) has the molecular formula C7H6F7NS and a molecular weight of 269.19 g/mol. Its IUPAC name is 2-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfanylacetonitrile.
| Compound Name | 2-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfanylacetonitrile |
|---|---|
| PubChem CID | 86761605 |
| Molecular Formula | C7H6F7NS |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 2-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfanylacetonitrile |
| SMILES | N#CCSCCC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6F7NS/c8-5(6(9,10)11,7(12,13)14)1-3-16-4-2-15/h1,3-4H2 |
| InChIKey | PPUIBFMQNNKXQY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|