C20H25ClN4O5 — CID 86762082
5-[(3R,4S)-4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-2-methoxybenzoic acid (PubChem CID 86762082) has the molecular formula C20H25ClN4O5 and a molecular weight of 436.90 g/mol. Its IUPAC name is 5-[(3R,4S)-4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-2-methoxybenzoic acid.
| Compound Name | 5-[(3R,4S)-4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 86762082 |
| Molecular Formula | C20H25ClN4O5 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 5-[(3R,4S)-4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-2-methoxybenzoic acid |
| SMILES | CCc1[nH]c(C(=O)N[C@H]2CCN(c3ccc(OC)c(C(=O)O)c3)C[C@H]2OC)nc1Cl |
| InChI | InChI=1S/C20H25ClN4O5/c1-4-13-17(21)24-18(22-13)19(26)23-14-7-8-25(10-16(14)30-3)11-5-6-15(29-2)12(9-11)20(27)28/h5-6,9,14,16H,4,7-8,10H2,1-3H3,(H,22,24)(H,23,26)(H,27,28)/t14-,16+/m0/s1 |
| InChIKey | DNTGGGIXKHAHRY-GOEBONIOSA-N |
| XLogP | 2.36 |
| TPSA | 116.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|