C19H17F3N4O3S — CID 86762164
N-[3-[(4aR,7aR)-2-amino-4,4a,5,6-tetrahydrofuro[2,3-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-(difluoromethoxy)pyridine-2-carboxamide (PubChem CID 86762164) has the molecular formula C19H17F3N4O3S and a molecular weight of 438.43 g/mol. Its IUPAC name is N-[3-[(4aR,7aR)-2-amino-4,4a,5,6-tetrahydrofuro[2,3-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-(difluoromethoxy)pyridine-2-carboxamide.
| Compound Name | N-[3-[(4aR,7aR)-2-amino-4,4a,5,6-tetrahydrofuro[2,3-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-(difluoromethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 86762164 |
| Molecular Formula | C19H17F3N4O3S |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | N-[3-[(4aR,7aR)-2-amino-4,4a,5,6-tetrahydrofuro[2,3-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-5-(difluoromethoxy)pyridine-2-carboxamide |
| SMILES | NC1=N[C@@]2(c3cc(NC(=O)c4ccc(OC(F)F)cn4)ccc3F)OCC[C@H]2CS1 |
| InChI | InChI=1S/C19H17F3N4O3S/c20-14-3-1-11(25-16(27)15-4-2-12(8-24-15)29-17(21)22)7-13(14)19-10(5-6-28-19)9-30-18(23)26-19/h1-4,7-8,10,17H,5-6,9H2,(H2,23,26)(H,25,27)/t10-,19+/m0/s1 |
| InChIKey | QPKXZCVPZROCAR-APBUJDDRSA-N |
| XLogP | 3.33 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |