About methyl 2-methylprop-2-enoate;styrene;3-trimethoxysilylpropyl 2-methylprop-2-enoate
methyl 2-methylprop-2-enoate;styrene;3-trimethoxysilylpropyl 2-methylprop-2-enoate (PubChem CID 86762181) has the molecular formula C23H36O7Si
and a molecular weight of 452.62 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;styrene;3-trimethoxysilylpropyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | methyl 2-methylprop-2-enoate;styrene;3-trimethoxysilylpropyl 2-methylprop-2-enoate |
| PubChem CID | 86762181 |
| Molecular Formula | C23H36O7Si |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | methyl 2-methylprop-2-enoate;styrene;3-trimethoxysilylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OCCC[Si](OC)(OC)OC.C=Cc1ccccc1 |
| InChI | InChI=1S/C10H20O5Si.C8H8.C5H8O2/c1-9(2)10(11)15-7-6-8-16(12-3,13-4)14-5;1-2-8-6-4-3-5-7-8;1-4(2)5(6)7-3/h1,6-8H2,2-5H3;2-7H,1H2;1H2,2-3H3 |
| InChIKey | QZLOPPQAJWDQEJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methylprop-2-enoate;styrene;3-trimethoxysilylpropyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methylprop-2-enoate;styrene;3-trimethoxysilylpropyl 2-methylprop-2-enoate?
The IUPAC name of methyl 2-methylprop-2-enoate;styrene;3-trimethoxysilylpropyl 2-methylprop-2-enoate (CID 86762181) is methyl 2-methylprop-2-enoate;styrene;3-trimethoxysilylpropyl 2-methylprop-2-enoate.
What is the SMILES notation for methyl 2-methylprop-2-enoate;styrene;3-trimethoxysilylpropyl 2-methylprop-2-enoate?
The canonical SMILES for methyl 2-methylprop-2-enoate;styrene;3-trimethoxysilylpropyl 2-methylprop-2-enoate is C=C(C)C(=O)OC.C=C(C)C(=O)OCCC[Si](OC)(OC)OC.C=Cc1ccccc1.
What is the InChIKey of methyl 2-methylprop-2-enoate;styrene;3-trimethoxysilylpropyl 2-methylprop-2-enoate?
The InChIKey is QZLOPPQAJWDQEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O5Si.C8H8.C5H8O2/c1-9(2)10(11)15-7-6-8-16(12-3,13-4)14-5;1-2-8-6-4-3-5-7-8;1-4(2)5(6)7-3/h1,6-8H2,2-5H3;2-7H,1H2;1H2,2-3H3.
What are the key properties of methyl 2-methylprop-2-enoate;styrene;3-trimethoxysilylpropyl 2-methylprop-2-enoate?
methyl 2-methylprop-2-enoate;styrene;3-trimethoxysilylpropyl 2-methylprop-2-enoate has a molecular weight of 452.62 g/mol, XLogP of 4.44, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylprop-2-enoate;styrene;3-trimethoxysilylpropyl 2-methylprop-2-enoate is sourced from PubChem (CID 86762181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).