About SCHEMBL12527350
SCHEMBL12527350 (PubChem CID 86762259) has the molecular formula C28H29Cl2F3N4O4
and a molecular weight of 613.46 g/mol.
Molecular Properties
| Compound Name | SCHEMBL12527350 |
| PubChem CID | 86762259 |
| Molecular Formula | C28H29Cl2F3N4O4 |
| Molecular Weight | 613.46 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | — |
| SMILES | O=C(N[C@@H]1CC[C@@H](CO)OC1)[C@@H]1NC2(CC(CF)(CF)C2)[C@@]2(C(=O)Nc3cc(Cl)ccc32)[C@H]1c1ccnc(Cl)c1F |
| InChI | InChI=1S/C28H29Cl2F3N4O4/c29-14-1-4-18-19(7-14)36-25(40)28(18)20(17-5-6-34-23(30)21(17)33)22(37-27(28)10-26(11-27,12-31)13-32)24(39)35-15-2-3-16(8-38)41-9-15/h1,4-7,15-16,20,22,37-38H,2-3,8-13H2,(H,35,39)(H,36,40)/t15-,16+,20+,22-,28-/m1/s1 |
| InChIKey | DSEDOTBBQDOCSZ-JOXBIMCSSA-N |
| XLogP | 3.59 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 613.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze SCHEMBL12527350 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of SCHEMBL12527350?
The IUPAC name of SCHEMBL12527350 (CID 86762259) is not available.
What is the SMILES notation for SCHEMBL12527350?
The canonical SMILES for SCHEMBL12527350 is O=C(N[C@@H]1CC[C@@H](CO)OC1)[C@@H]1NC2(CC(CF)(CF)C2)[C@@]2(C(=O)Nc3cc(Cl)ccc32)[C@H]1c1ccnc(Cl)c1F.
What is the InChIKey of SCHEMBL12527350?
The InChIKey is DSEDOTBBQDOCSZ-JOXBIMCSSA-N. The full InChI is InChI=1S/C28H29Cl2F3N4O4/c29-14-1-4-18-19(7-14)36-25(40)28(18)20(17-5-6-34-23(30)21(17)33)22(37-27(28)10-26(11-27,12-31)13-32)24(39)35-15-2-3-16(8-38)41-9-15/h1,4-7,15-16,20,22,37-38H,2-3,8-13H2,(H,35,39)(H,36,40)/t15-,16+,20+,22-,28-/m1/s1.
What are the key properties of SCHEMBL12527350?
SCHEMBL12527350 has a molecular weight of 613.46 g/mol, XLogP of 3.59, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for SCHEMBL12527350 is sourced from PubChem (CID 86762259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).